C18H27FN4OS — CID 102559839
3-fluoro-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide (PubChem CID 102559839) has the molecular formula C18H27FN4OS and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-fluoro-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | 3-fluoro-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 102559839 |
| Molecular Formula | C18H27FN4OS |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-fluoro-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide |
| SMILES | CC(C)n1c(CCNC(=O)C23CC4CC(CC(F)(C4)C2)C3)n[nH]c1=S |
| InChI | InChI=1S/C18H27FN4OS/c1-11(2)23-14(21-22-16(23)25)3-4-20-15(24)17-6-12-5-13(7-17)9-18(19,8-12)10-17/h11-13H,3-10H2,1-2H3,(H,20,24)(H,22,25) |
| InChIKey | UYWABVUSBPGLEY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|