C16H20N2O3S — CID 102559906
1-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 102559906) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 102559906 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | Cc1ncc(/C=C/C(=O)N2C(C(=O)O)CC3CCCCC32)s1 |
| InChI | InChI=1S/C16H20N2O3S/c1-10-17-9-12(22-10)6-7-15(19)18-13-5-3-2-4-11(13)8-14(18)16(20)21/h6-7,9,11,13-14H,2-5,8H2,1H3,(H,20,21)/b7-6+ |
| InChIKey | SWKJWBGZMPMNOI-VOTSOKGWSA-N |
| XLogP | 2.71 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|