C17H22N4O2S2 — CID 102559979
N-(6-oxaspiro[4.5]decan-9-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 102559979) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(6-oxaspiro[4.5]decan-9-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(6-oxaspiro[4.5]decan-9-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 102559979 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(6-oxaspiro[4.5]decan-9-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)NC1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H22N4O2S2/c22-14(18-12-5-8-23-17(10-12)6-1-2-7-17)11-21-15(19-20-16(21)24)13-4-3-9-25-13/h3-4,9,12H,1-2,5-8,10-11H2,(H,18,22)(H,20,24) |
| InChIKey | QTAKWQPOADCQHL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|