C16H22ClFN2O — CID 102560004
[3-(2-fluorophenyl)pyrrolidin-1-yl]-piperidin-2-ylmethanone;hydrochloride (PubChem CID 102560004) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is [3-(2-fluorophenyl)pyrrolidin-1-yl]-piperidin-2-ylmethanone;hydrochloride.
| Compound Name | [3-(2-fluorophenyl)pyrrolidin-1-yl]-piperidin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 102560004 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [3-(2-fluorophenyl)pyrrolidin-1-yl]-piperidin-2-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCCN1)N1CCC(c2ccccc2F)C1 |
| InChI | InChI=1S/C16H21FN2O.ClH/c17-14-6-2-1-5-13(14)12-8-10-19(11-12)16(20)15-7-3-4-9-18-15;/h1-2,5-6,12,15,18H,3-4,7-11H2;1H |
| InChIKey | CYMONBZYFGVNSC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |