C17H20ClNO2 — CID 102560275
N-[(2-chlorophenyl)methyl]-N-methyl-8-oxobicyclo[3.2.1]octane-3-carboxamide (PubChem CID 102560275) has the molecular formula C17H20ClNO2 and a molecular weight of 305.80 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-methyl-8-oxobicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-methyl-8-oxobicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 102560275 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-methyl-8-oxobicyclo[3.2.1]octane-3-carboxamide |
| SMILES | CN(Cc1ccccc1Cl)C(=O)C1CC2CCC(C1)C2=O |
| InChI | InChI=1S/C17H20ClNO2/c1-19(10-13-4-2-3-5-15(13)18)17(21)14-8-11-6-7-12(9-14)16(11)20/h2-5,11-12,14H,6-10H2,1H3 |
| InChIKey | XBNJEJMSEQRZQP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |