C13H20N2O4S — CID 102561165
2-(2-methylsulfonylethyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione (PubChem CID 102561165) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(2-methylsulfonylethyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione.
| Compound Name | 2-(2-methylsulfonylethyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione |
|---|---|
| PubChem CID | 102561165 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-(2-methylsulfonylethyl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione |
| SMILES | CS(=O)(=O)CCN1C(=O)C2CC3CCCCC3N2C1=O |
| InChI | InChI=1S/C13H20N2O4S/c1-20(18,19)7-6-14-12(16)11-8-9-4-2-3-5-10(9)15(11)13(14)17/h9-11H,2-8H2,1H3 |
| InChIKey | FSBOEHYQQQZCLZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|