C16H19NO3S2 — CID 102562312
2-ethylsulfonyl-N-[(4-methylsulfinylphenyl)methyl]aniline (PubChem CID 102562312) has the molecular formula C16H19NO3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-[(4-methylsulfinylphenyl)methyl]aniline.
| Compound Name | 2-ethylsulfonyl-N-[(4-methylsulfinylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 102562312 |
| Molecular Formula | C16H19NO3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-ethylsulfonyl-N-[(4-methylsulfinylphenyl)methyl]aniline |
| SMILES | CCS(=O)(=O)c1ccccc1NCc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C16H19NO3S2/c1-3-22(19,20)16-7-5-4-6-15(16)17-12-13-8-10-14(11-9-13)21(2)18/h4-11,17H,3,12H2,1-2H3 |
| InChIKey | MJCBRPGTWYOQDB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |