About N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide
N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 102562327) has the molecular formula C14H13BrF2N2O2S
and a molecular weight of 391.24 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 102562327 |
| Molecular Formula | C14H13BrF2N2O2S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCOC(C)c1nc(C(=O)Nc2cc(Br)c(F)cc2F)cs1 |
| InChI | InChI=1S/C14H13BrF2N2O2S/c1-3-21-7(2)14-19-12(6-22-14)13(20)18-11-4-8(15)9(16)5-10(11)17/h4-7H,3H2,1-2H3,(H,18,20) |
| InChIKey | BQBQMVBGORQDFE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide (CID 102562327) is N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide is CCOC(C)c1nc(C(=O)Nc2cc(Br)c(F)cc2F)cs1.
What is the InChIKey of N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide?
The InChIKey is BQBQMVBGORQDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrF2N2O2S/c1-3-21-7(2)14-19-12(6-22-14)13(20)18-11-4-8(15)9(16)5-10(11)17/h4-7H,3H2,1-2H3,(H,18,20).
What are the key properties of N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide?
N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide has a molecular weight of 391.24 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2,4-difluorophenyl)-2-(1-ethoxyethyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 102562327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).