C15H24N4O — CID 102562540
4-[2-(2-ethylpyrazol-3-yl)ethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 102562540) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[2-(2-ethylpyrazol-3-yl)ethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | 4-[2-(2-ethylpyrazol-3-yl)ethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 102562540 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[2-(2-ethylpyrazol-3-yl)ethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | CCn1nccc1CCN1CC(=O)NC2CCCCC21 |
| InChI | InChI=1S/C15H24N4O/c1-2-19-12(7-9-16-19)8-10-18-11-15(20)17-13-5-3-4-6-14(13)18/h7,9,13-14H,2-6,8,10-11H2,1H3,(H,17,20) |
| InChIKey | MFMCFZYAMZAUFB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |