About N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide
N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide (PubChem CID 102562548) has the molecular formula C21H41N5O3
and a molecular weight of 411.59 g/mol. Its IUPAC name is N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide |
| PubChem CID | 102562548 |
| Molecular Formula | C21H41N5O3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide |
| SMILES | CC1CN(CCN2CCN(CCN3CCOC(C)C3)C(C(=O)N(C)C)C2)CCO1 |
| InChI | InChI=1S/C21H41N5O3/c1-18-15-24(11-13-28-18)6-5-23-7-9-26(20(17-23)21(27)22(3)4)10-8-25-12-14-29-19(2)16-25/h18-20H,5-17H2,1-4H3 |
| InChIKey | FAMDWXUJGPDEHX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 51.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide?
The IUPAC name of N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide (CID 102562548) is N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide.
What is the SMILES notation for N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide?
The canonical SMILES for N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide is CC1CN(CCN2CCN(CCN3CCOC(C)C3)C(C(=O)N(C)C)C2)CCO1.
What is the InChIKey of N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide?
The InChIKey is FAMDWXUJGPDEHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41N5O3/c1-18-15-24(11-13-28-18)6-5-23-7-9-26(20(17-23)21(27)22(3)4)10-8-25-12-14-29-19(2)16-25/h18-20H,5-17H2,1-4H3.
What are the key properties of N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide?
N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide has a molecular weight of 411.59 g/mol, XLogP of -0.50, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,4-bis[2-(2-methylmorpholin-4-yl)ethyl]piperazine-2-carboxamide is sourced from PubChem (CID 102562548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).