C20H30N2O3 — CID 102562883
methyl 2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methylcarbamoyl]butanoate (PubChem CID 102562883) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl 2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methylcarbamoyl]butanoate.
| Compound Name | methyl 2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methylcarbamoyl]butanoate |
|---|---|
| PubChem CID | 102562883 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | methyl 2-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methylcarbamoyl]butanoate |
| SMILES | CCC(C(=O)NCc1cccc(CN2CCC(C)CC2)c1)C(=O)OC |
| InChI | InChI=1S/C20H30N2O3/c1-4-18(20(24)25-3)19(23)21-13-16-6-5-7-17(12-16)14-22-10-8-15(2)9-11-22/h5-7,12,15,18H,4,8-11,13-14H2,1-3H3,(H,21,23) |
| InChIKey | YKZCWMKCBZZIMG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|