C26H41ClN4O5 — CID 10256290
(2R)-2-[4-(4-chlorophenoxy)butyl]-N-[(2S)-3,3-dimethyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]-N'-hydroxybutanediamide (PubChem CID 10256290) has the molecular formula C26H41ClN4O5 and a molecular weight of 525.09 g/mol. Its IUPAC name is (2R)-2-[4-(4-chlorophenoxy)butyl]-N-[(2S)-3,3-dimethyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]-N'-hydroxybutanediamide.
| Compound Name | (2R)-2-[4-(4-chlorophenoxy)butyl]-N-[(2S)-3,3-dimethyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 10256290 |
| Molecular Formula | C26H41ClN4O5 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | (2R)-2-[4-(4-chlorophenoxy)butyl]-N-[(2S)-3,3-dimethyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]-N'-hydroxybutanediamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CCCCOc1ccc(Cl)cc1)CC(=O)NO)C(=O)NCCN1CCCC1 |
| InChI | InChI=1S/C26H41ClN4O5/c1-26(2,3)23(25(34)28-13-16-31-14-5-6-15-31)29-24(33)19(18-22(32)30-35)8-4-7-17-36-21-11-9-20(27)10-12-21/h9-12,19,23,35H,4-8,13-18H2,1-3H3,(H,28,34)(H,29,33)(H,30,32)/t19-,23-/m1/s1 |
| InChIKey | RLERLGNKRGQTKW-AUSIDOKSSA-N |
| XLogP | 3.14 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|