C31H35N5O3 — CID 10256309
6-amino-1-[4-[3-(4-benzhydrylpiperazin-1-yl)propoxy]phenyl]-3-methylpyrimidine-2,4-dione (PubChem CID 10256309) has the molecular formula C31H35N5O3 and a molecular weight of 525.65 g/mol. Its IUPAC name is 6-amino-1-[4-[3-(4-benzhydrylpiperazin-1-yl)propoxy]phenyl]-3-methylpyrimidine-2,4-dione.
| Compound Name | 6-amino-1-[4-[3-(4-benzhydrylpiperazin-1-yl)propoxy]phenyl]-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10256309 |
| Molecular Formula | C31H35N5O3 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 6-amino-1-[4-[3-(4-benzhydrylpiperazin-1-yl)propoxy]phenyl]-3-methylpyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(N)n(-c2ccc(OCCCN3CCN(C(c4ccccc4)c4ccccc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C31H35N5O3/c1-33-29(37)23-28(32)36(31(33)38)26-13-15-27(16-14-26)39-22-8-17-34-18-20-35(21-19-34)30(24-9-4-2-5-10-24)25-11-6-3-7-12-25/h2-7,9-16,23,30H,8,17-22,32H2,1H3 |
| InChIKey | DQGZMFSUONRPKE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|