About 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole
5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole (PubChem CID 102563319) has the molecular formula C15H12N6OS
and a molecular weight of 324.37 g/mol. Its IUPAC name is 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole |
| PubChem CID | 102563319 |
| Molecular Formula | C15H12N6OS |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole |
| SMILES | CC(Sc1ncnc2nc[nH]c12)c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H12N6OS/c1-9(23-15-11-13(17-7-16-11)18-8-19-15)12-20-14(22-21-12)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17,18,19) |
| InChIKey | NDYAVLTUJDNESM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole?
The IUPAC name of 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole (CID 102563319) is 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole.
What is the SMILES notation for 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole?
The canonical SMILES for 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole is CC(Sc1ncnc2nc[nH]c12)c1noc(-c2ccccc2)n1.
What is the InChIKey of 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole?
The InChIKey is NDYAVLTUJDNESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N6OS/c1-9(23-15-11-13(17-7-16-11)18-8-19-15)12-20-14(22-21-12)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17,18,19).
What are the key properties of 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole?
5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole has a molecular weight of 324.37 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-3-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,2,4-oxadiazole is sourced from PubChem (CID 102563319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).