About 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride
1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride (PubChem CID 102564309) has the molecular formula C12H17Cl2N3O
and a molecular weight of 290.19 g/mol. Its IUPAC name is 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride.
Molecular Properties
| Compound Name | 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride |
| PubChem CID | 102564309 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride |
| SMILES | CN1C(=O)C2(CCCNC2)c2ncccc21.Cl.Cl |
| InChI | InChI=1S/C12H15N3O.2ClH/c1-15-9-4-2-7-14-10(9)12(11(15)16)5-3-6-13-8-12;;/h2,4,7,13H,3,5-6,8H2,1H3;2*1H |
| InChIKey | JJFXCMMDFUNTDT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride?
The IUPAC name of 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride (CID 102564309) is 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride.
What is the SMILES notation for 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride?
The canonical SMILES for 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride is CN1C(=O)C2(CCCNC2)c2ncccc21.Cl.Cl.
What is the InChIKey of 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride?
The InChIKey is JJFXCMMDFUNTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O.2ClH/c1-15-9-4-2-7-14-10(9)12(11(15)16)5-3-6-13-8-12;;/h2,4,7,13H,3,5-6,8H2,1H3;2*1H.
What are the key properties of 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride?
1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride has a molecular weight of 290.19 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[piperidine-3,3'-pyrrolo[3,2-b]pyridine]-2'-one;dihydrochloride is sourced from PubChem (CID 102564309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).