C26H22O6 — CID 102564616
10-(4-oxochromen-3-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione (PubChem CID 102564616) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 10-(4-oxochromen-3-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione.
| Compound Name | 10-(4-oxochromen-3-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione |
|---|---|
| PubChem CID | 102564616 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 10-(4-oxochromen-3-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione |
| SMILES | O=C1CC(c2coc3ccccc3c2=O)c2c(ccc3c2OC2(CCCCC2)CC3=O)O1 |
| InChI | InChI=1S/C26H22O6/c27-19-13-26(10-4-1-5-11-26)32-25-15(19)8-9-21-23(25)17(12-22(28)31-21)18-14-30-20-7-3-2-6-16(20)24(18)29/h2-3,6-9,14,17H,1,4-5,10-13H2 |
| InChIKey | JGLTVONHYUYORL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|