C29H41NO8 — CID 10256499
ethyl (3S,4R,5R)-4-(dibenzylamino)-3-hydroxy-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pentanoate (PubChem CID 10256499) has the molecular formula C29H41NO8 and a molecular weight of 531.65 g/mol. Its IUPAC name is ethyl (3S,4R,5R)-4-(dibenzylamino)-3-hydroxy-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pentanoate.
| Compound Name | ethyl (3S,4R,5R)-4-(dibenzylamino)-3-hydroxy-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pentanoate |
|---|---|
| PubChem CID | 10256499 |
| Molecular Formula | C29H41NO8 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | ethyl (3S,4R,5R)-4-(dibenzylamino)-3-hydroxy-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pentanoate |
| SMILES | CCOC(=O)C[C@H](O)[C@H]([C@@H](OCOC)[C@@H]1OC(C)(C)O[C@H]1CO)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H41NO8/c1-5-35-25(33)16-23(32)26(28(36-20-34-4)27-24(19-31)37-29(2,3)38-27)30(17-21-12-8-6-9-13-21)18-22-14-10-7-11-15-22/h6-15,23-24,26-28,31-32H,5,16-20H2,1-4H3/t23-,24-,26+,27+,28+/m0/s1 |
| InChIKey | WYYMYTSWRCNFBW-VUSPDJBOSA-N |
| XLogP | 2.87 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|