About 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride
1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride (PubChem CID 102565631) has the molecular formula C8H18Cl2N4
and a molecular weight of 241.17 g/mol. Its IUPAC name is 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride |
| PubChem CID | 102565631 |
| Molecular Formula | C8H18Cl2N4 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride |
| SMILES | CCCNc1nn(CC)cc1N.Cl.Cl |
| InChI | InChI=1S/C8H16N4.2ClH/c1-3-5-10-8-7(9)6-12(4-2)11-8;;/h6H,3-5,9H2,1-2H3,(H,10,11);2*1H |
| InChIKey | RJYNXMCRZMOJEM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride?
The IUPAC name of 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride (CID 102565631) is 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride.
What is the SMILES notation for 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride?
The canonical SMILES for 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride is CCCNc1nn(CC)cc1N.Cl.Cl.
What is the InChIKey of 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride?
The InChIKey is RJYNXMCRZMOJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4.2ClH/c1-3-5-10-8-7(9)6-12(4-2)11-8;;/h6H,3-5,9H2,1-2H3,(H,10,11);2*1H.
What are the key properties of 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride?
1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride has a molecular weight of 241.17 g/mol, XLogP of 2.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-N-propylpyrazole-3,4-diamine;dihydrochloride is sourced from PubChem (CID 102565631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).