C29H31N5O3 — CID 10256583
1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 10256583) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 10256583 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | COc1cc2nc(N3CCN(C(=O)CC(c4ccccc4)c4ccccc4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C29H31N5O3/c1-36-25-17-23-24(19-26(25)37-2)31-29(32-28(23)30)34-15-13-33(14-16-34)27(35)18-22(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,17,19,22H,13-16,18H2,1-2H3,(H2,30,31,32) |
| InChIKey | OQDVCLJHYBLHNT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |