C16H16ClN3O — CID 102567101
2-methyl-3-[(pyridin-2-ylamino)methyl]-1H-quinolin-4-one;hydrochloride (PubChem CID 102567101) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 2-methyl-3-[(pyridin-2-ylamino)methyl]-1H-quinolin-4-one;hydrochloride.
| Compound Name | 2-methyl-3-[(pyridin-2-ylamino)methyl]-1H-quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 102567101 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-methyl-3-[(pyridin-2-ylamino)methyl]-1H-quinolin-4-one;hydrochloride |
| SMILES | Cc1[nH]c2ccccc2c(=O)c1CNc1ccccn1.Cl |
| InChI | InChI=1S/C16H15N3O.ClH/c1-11-13(10-18-15-8-4-5-9-17-15)16(20)12-6-2-3-7-14(12)19-11;/h2-9H,10H2,1H3,(H,17,18)(H,19,20);1H |
| InChIKey | MCVUKEKFMAXLBV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |