C6H7NO5S — CID 102567552
5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,2]oxazole-3-carboxylic acid (PubChem CID 102567552) has the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. Its IUPAC name is 5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,2]oxazole-3-carboxylic acid.
| Compound Name | 5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,2]oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 102567552 |
| Molecular Formula | C6H7NO5S |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,2]oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC2CS(=O)(=O)CC12 |
| InChI | InChI=1S/C6H7NO5S/c8-6(9)5-3-1-13(10,11)2-4(3)12-7-5/h3-4H,1-2H2,(H,8,9) |
| InChIKey | OFQTVRVEZKDMKD-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |