About ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate
ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate (PubChem CID 10256802) has the molecular formula C23H18Cl2FNO7S
and a molecular weight of 542.37 g/mol. Its IUPAC name is ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate |
| PubChem CID | 10256802 |
| Molecular Formula | C23H18Cl2FNO7S |
| Molecular Weight | 542.37 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)c3ccc(F)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2FNO7S/c1-2-33-22(30)12-21(29)27-14-9-17(24)23(18(25)10-14)34-15-5-8-19(28)20(11-15)35(31,32)16-6-3-13(26)4-7-16/h3-11,28H,2,12H2,1H3,(H,27,29) |
| InChIKey | BPUZMGOUMNXQLN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate?
The IUPAC name of ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate (CID 10256802) is ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate.
What is the SMILES notation for ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate?
The canonical SMILES for ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate is CCOC(=O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)c3ccc(F)cc3)c2)c(Cl)c1.
What is the InChIKey of ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate?
The InChIKey is BPUZMGOUMNXQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18Cl2FNO7S/c1-2-33-22(30)12-21(29)27-14-9-17(24)23(18(25)10-14)34-15-5-8-19(28)20(11-15)35(31,32)16-6-3-13(26)4-7-16/h3-11,28H,2,12H2,1H3,(H,27,29).
What are the key properties of ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate?
ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate has a molecular weight of 542.37 g/mol, XLogP of 5.35, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate is sourced from PubChem (CID 10256802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).