C10H9Br2NO — CID 102568571
5-(bromomethyl)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 102568571) has the molecular formula C10H9Br2NO and a molecular weight of 319.00 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(bromomethyl)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 102568571 |
| Molecular Formula | C10H9Br2NO |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 316.91 |
| IUPAC Name | 5-(bromomethyl)-3-(4-bromophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | BrCC1CC(c2ccc(Br)cc2)=NO1 |
| InChI | InChI=1S/C10H9Br2NO/c11-6-9-5-10(13-14-9)7-1-3-8(12)4-2-7/h1-4,9H,5-6H2 |
| InChIKey | XROJCYFOVGWWTL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|