C9H17NO3S2 — CID 102568956
1-(ethoxymethyl)-2-ethylsulfonylcyclopropane-1-carbothioamide (PubChem CID 102568956) has the molecular formula C9H17NO3S2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(ethoxymethyl)-2-ethylsulfonylcyclopropane-1-carbothioamide.
| Compound Name | 1-(ethoxymethyl)-2-ethylsulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 102568956 |
| Molecular Formula | C9H17NO3S2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 1-(ethoxymethyl)-2-ethylsulfonylcyclopropane-1-carbothioamide |
| SMILES | CCOCC1(C(N)=S)CC1S(=O)(=O)CC |
| InChI | InChI=1S/C9H17NO3S2/c1-3-13-6-9(8(10)14)5-7(9)15(11,12)4-2/h7H,3-6H2,1-2H3,(H2,10,14) |
| InChIKey | HJTWZFHWVCPBOC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|