C17H19NO4S — CID 102569320
[1-amino-2-(benzenesulfonyl)-3-(4-methoxyphenyl)cyclopropyl]methanol (PubChem CID 102569320) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is [1-amino-2-(benzenesulfonyl)-3-(4-methoxyphenyl)cyclopropyl]methanol.
| Compound Name | [1-amino-2-(benzenesulfonyl)-3-(4-methoxyphenyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 102569320 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [1-amino-2-(benzenesulfonyl)-3-(4-methoxyphenyl)cyclopropyl]methanol |
| SMILES | COc1ccc(C2C(S(=O)(=O)c3ccccc3)C2(N)CO)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-22-13-9-7-12(8-10-13)15-16(17(15,18)11-19)23(20,21)14-5-3-2-4-6-14/h2-10,15-16,19H,11,18H2,1H3 |
| InChIKey | ALWJDKVZIBLYRE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |