C30H25ClO8 — CID 10256957
(3R)-7-chloro-3,8,9-trihydroxy-3-methyl-10-[(6R)-1,6,9-trihydroxy-6-methyl-8-oxo-5,7-dihydroanthracen-2-yl]-2,4-dihydroanthracen-1-one (PubChem CID 10256957) has the molecular formula C30H25ClO8 and a molecular weight of 548.98 g/mol. Its IUPAC name is (3R)-7-chloro-3,8,9-trihydroxy-3-methyl-10-[(6R)-1,6,9-trihydroxy-6-methyl-8-oxo-5,7-dihydroanthracen-2-yl]-2,4-dihydroanthracen-1-one.
| Compound Name | (3R)-7-chloro-3,8,9-trihydroxy-3-methyl-10-[(6R)-1,6,9-trihydroxy-6-methyl-8-oxo-5,7-dihydroanthracen-2-yl]-2,4-dihydroanthracen-1-one |
|---|---|
| PubChem CID | 10256957 |
| Molecular Formula | C30H25ClO8 |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | (3R)-7-chloro-3,8,9-trihydroxy-3-methyl-10-[(6R)-1,6,9-trihydroxy-6-methyl-8-oxo-5,7-dihydroanthracen-2-yl]-2,4-dihydroanthracen-1-one |
| SMILES | C[C@]1(O)CC(=O)c2c(cc3ccc(-c4c5c(c(O)c6c(O)c(Cl)ccc46)C(=O)C[C@](C)(O)C5)c(O)c3c2O)C1 |
| InChI | InChI=1S/C30H25ClO8/c1-29(38)8-13-7-12-3-4-15(25(34)21(12)27(36)20(13)18(32)10-29)22-14-5-6-17(31)26(35)24(14)28(37)23-16(22)9-30(2,39)11-19(23)33/h3-7,34-39H,8-11H2,1-2H3/t29-,30-/m1/s1 |
| InChIKey | PMEREXIQNWQBJU-LOYHVIPDSA-N |
| XLogP | 4.90 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |