C25H30BrFN4O4 — CID 10256963
1-[3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]propyl]pyrrolidine-2-carboxylic acid (PubChem CID 10256963) has the molecular formula C25H30BrFN4O4 and a molecular weight of 549.44 g/mol. Its IUPAC name is 1-[3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]propyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]propyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10256963 |
| Molecular Formula | C25H30BrFN4O4 |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 1-[3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]propyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(Br)cc1CCc1c(F)cccc1C(=O)N/C(N)=N/CCCN1CCCC1C(=O)O |
| InChI | InChI=1S/C25H30BrFN4O4/c1-35-22-11-9-17(26)15-16(22)8-10-18-19(5-2-6-20(18)27)23(32)30-25(28)29-12-4-14-31-13-3-7-21(31)24(33)34/h2,5-6,9,11,15,21H,3-4,7-8,10,12-14H2,1H3,(H,33,34)(H3,28,29,30,32) |
| InChIKey | YZJQFPLTAFBKSI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|