C12H12FNO3S — CID 102570100
2-(4-fluorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carbonitrile (PubChem CID 102570100) has the molecular formula C12H12FNO3S and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carbonitrile.
| Compound Name | 2-(4-fluorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 102570100 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carbonitrile |
| SMILES | CS(=O)(=O)C1C(c2ccc(F)cc2)C1(C#N)CO |
| InChI | InChI=1S/C12H12FNO3S/c1-18(16,17)11-10(12(11,6-14)7-15)8-2-4-9(13)5-3-8/h2-5,10-11,15H,7H2,1H3 |
| InChIKey | DFUKXFOYOMYCFU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |