C12H13ClO5S — CID 102570151
2-(3-chlorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carboxylic acid (PubChem CID 102570151) has the molecular formula C12H13ClO5S and a molecular weight of 304.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carboxylic acid.
| Compound Name | 2-(3-chlorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 102570151 |
| Molecular Formula | C12H13ClO5S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(hydroxymethyl)-3-methylsulfonylcyclopropane-1-carboxylic acid |
| SMILES | CS(=O)(=O)C1C(c2cccc(Cl)c2)C1(CO)C(=O)O |
| InChI | InChI=1S/C12H13ClO5S/c1-19(17,18)10-9(12(10,6-14)11(15)16)7-3-2-4-8(13)5-7/h2-5,9-10,14H,6H2,1H3,(H,15,16) |
| InChIKey | VBPMWKAAGQGWIR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |