C15H18ClNO3S — CID 102570181
2-(4-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbonitrile (PubChem CID 102570181) has the molecular formula C15H18ClNO3S and a molecular weight of 327.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbonitrile.
| Compound Name | 2-(4-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 102570181 |
| Molecular Formula | C15H18ClNO3S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbonitrile |
| SMILES | CCOCC1(C#N)C(c2ccc(Cl)cc2)C1S(=O)(=O)CC |
| InChI | InChI=1S/C15H18ClNO3S/c1-3-20-10-15(9-17)13(14(15)21(18,19)4-2)11-5-7-12(16)8-6-11/h5-8,13-14H,3-4,10H2,1-2H3 |
| InChIKey | ZIILAHBQBJDNEC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |