C20H24O4S — CID 102570239
[2-(4-ethylphenyl)-1-(hydroxymethyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol (PubChem CID 102570239) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-1-(hydroxymethyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol.
| Compound Name | [2-(4-ethylphenyl)-1-(hydroxymethyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol |
|---|---|
| PubChem CID | 102570239 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [2-(4-ethylphenyl)-1-(hydroxymethyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol |
| SMILES | CCc1ccc(C2C(S(=O)(=O)c3ccc(C)cc3)C2(CO)CO)cc1 |
| InChI | InChI=1S/C20H24O4S/c1-3-15-6-8-16(9-7-15)18-19(20(18,12-21)13-22)25(23,24)17-10-4-14(2)5-11-17/h4-11,18-19,21-22H,3,12-13H2,1-2H3 |
| InChIKey | QQPZBFLRJJWFDG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |