C19H18FNO3S — CID 102570415
2-(benzenesulfonyl)-1-(ethoxymethyl)-3-(3-fluorophenyl)cyclopropane-1-carbonitrile (PubChem CID 102570415) has the molecular formula C19H18FNO3S and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-(ethoxymethyl)-3-(3-fluorophenyl)cyclopropane-1-carbonitrile.
| Compound Name | 2-(benzenesulfonyl)-1-(ethoxymethyl)-3-(3-fluorophenyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 102570415 |
| Molecular Formula | C19H18FNO3S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-(benzenesulfonyl)-1-(ethoxymethyl)-3-(3-fluorophenyl)cyclopropane-1-carbonitrile |
| SMILES | CCOCC1(C#N)C(c2cccc(F)c2)C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18FNO3S/c1-2-24-13-19(12-21)17(14-7-6-8-15(20)11-14)18(19)25(22,23)16-9-4-3-5-10-16/h3-11,17-18H,2,13H2,1H3 |
| InChIKey | HITWJLUVHAKRPZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |