C16H26O4 — CID 102571672
2,3-dihydroxy-1-(2-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)propan-1-one (PubChem CID 102571672) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2,3-dihydroxy-1-(2-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)propan-1-one.
| Compound Name | 2,3-dihydroxy-1-(2-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)propan-1-one |
|---|---|
| PubChem CID | 102571672 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2,3-dihydroxy-1-(2-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)propan-1-one |
| SMILES | CC1CCC2C(C=CC(C)(O)C2(C)C(=O)C(O)CO)C1 |
| InChI | InChI=1S/C16H26O4/c1-10-4-5-12-11(8-10)6-7-15(2,20)16(12,3)14(19)13(18)9-17/h6-7,10-13,17-18,20H,4-5,8-9H2,1-3H3 |
| InChIKey | OMMNYMRPMTVMRY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|