C16H17F3O3S — CID 102572086
1-[(1S,6R)-6-(benzenesulfonyl)-3,4-dimethylcyclohex-3-en-1-yl]-2,2,2-trifluoroethanone (PubChem CID 102572086) has the molecular formula C16H17F3O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-[(1S,6R)-6-(benzenesulfonyl)-3,4-dimethylcyclohex-3-en-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1S,6R)-6-(benzenesulfonyl)-3,4-dimethylcyclohex-3-en-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 102572086 |
| Molecular Formula | C16H17F3O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[(1S,6R)-6-(benzenesulfonyl)-3,4-dimethylcyclohex-3-en-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1=C(C)C[C@@H](C(=O)C(F)(F)F)[C@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H17F3O3S/c1-10-8-13(15(20)16(17,18)19)14(9-11(10)2)23(21,22)12-6-4-3-5-7-12/h3-7,13-14H,8-9H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | SMBDESHNPMHGEW-ZIAGYGMSSA-N |
| XLogP | 3.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|