C21H38O4 — CID 102572140
(3S,4S,5R)-4-hydroxy-3-(hydroxymethyl)-5-methyl-5-[(E)-pentadec-11-enyl]oxolan-2-one (PubChem CID 102572140) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-3-(hydroxymethyl)-5-methyl-5-[(E)-pentadec-11-enyl]oxolan-2-one.
| Compound Name | (3S,4S,5R)-4-hydroxy-3-(hydroxymethyl)-5-methyl-5-[(E)-pentadec-11-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 102572140 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-3-(hydroxymethyl)-5-methyl-5-[(E)-pentadec-11-enyl]oxolan-2-one |
| SMILES | CCC/C=C/CCCCCCCCCC[C@@]1(C)OC(=O)[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C21H38O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21(2)19(23)18(17-22)20(24)25-21/h5-6,18-19,22-23H,3-4,7-17H2,1-2H3/b6-5+/t18-,19-,21+/m0/s1 |
| InChIKey | MAPUWVOKJMDGSL-VDURDUQRSA-N |
| XLogP | 4.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|