C25H31NO5 — CID 102572419
(4aR,6R,7R,8S,8aS)-7-[(2S)-2-methylpyrrolidin-1-yl]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 102572419) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (4aR,6R,7R,8S,8aS)-7-[(2S)-2-methylpyrrolidin-1-yl]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,6R,7R,8S,8aS)-7-[(2S)-2-methylpyrrolidin-1-yl]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 102572419 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (4aR,6R,7R,8S,8aS)-7-[(2S)-2-methylpyrrolidin-1-yl]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | C[C@H]1CCCN1[C@H]1[C@H](OCc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C25H31NO5/c1-17-9-8-14-26(17)21-22(27)23-20(16-29-24(31-23)19-12-6-3-7-13-19)30-25(21)28-15-18-10-4-2-5-11-18/h2-7,10-13,17,20-25,27H,8-9,14-16H2,1H3/t17-,20+,21+,22-,23+,24?,25+/m0/s1 |
| InChIKey | XWFYNFHVGJZBGJ-UKLFIUMVSA-N |
| XLogP | 3.26 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |