C30H24N6O9 — CID 102573138
6,13,20-trinitro-2,9,16-tris(prop-2-enyl)-2,9,16-triazatetracyclo[16.3.1.14,8.111,15]tetracosa-1(21),4(24),5,7,11(23),12,14,18(22),19-nonaene-3,10,17-trione (PubChem CID 102573138) has the molecular formula C30H24N6O9 and a molecular weight of 612.56 g/mol. Its IUPAC name is 6,13,20-trinitro-2,9,16-tris(prop-2-enyl)-2,9,16-triazatetracyclo[16.3.1.14,8.111,15]tetracosa-1(21),4(24),5,7,11(23),12,14,18(22),19-nonaene-3,10,17-trione.
| Compound Name | 6,13,20-trinitro-2,9,16-tris(prop-2-enyl)-2,9,16-triazatetracyclo[16.3.1.14,8.111,15]tetracosa-1(21),4(24),5,7,11(23),12,14,18(22),19-nonaene-3,10,17-trione |
|---|---|
| PubChem CID | 102573138 |
| Molecular Formula | C30H24N6O9 |
| Molecular Weight | 612.56 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | 6,13,20-trinitro-2,9,16-tris(prop-2-enyl)-2,9,16-triazatetracyclo[16.3.1.14,8.111,15]tetracosa-1(21),4(24),5,7,11(23),12,14,18(22),19-nonaene-3,10,17-trione |
| SMILES | C=CCN1C(=O)c2cc(cc([N+](=O)[O-])c2)N(CC=C)C(=O)c2cc(cc([N+](=O)[O-])c2)N(CC=C)C(=O)c2cc1cc([N+](=O)[O-])c2 |
| InChI | InChI=1S/C30H24N6O9/c1-4-7-31-22-10-20(14-25(16-22)34(40)41)29(38)33(9-6-3)24-12-21(15-27(18-24)36(44)45)30(39)32(8-5-2)23-11-19(28(31)37)13-26(17-23)35(42)43/h4-6,10-18H,1-3,7-9H2 |
| InChIKey | MKSMSLQQKNPPFJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 190.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|