C32H58O7Si2 — CID 102573214
(1R,3R,6S,7R,9S,11R,13S,19S,20R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-20-tri(propan-2-yl)silyloxy-2,8,12,18-tetraoxatetracyclo[9.9.0.03,9.013,19]icosa-4,15-dien-6-ol (PubChem CID 102573214) has the molecular formula C32H58O7Si2 and a molecular weight of 610.98 g/mol. Its IUPAC name is (1R,3R,6S,7R,9S,11R,13S,19S,20R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-20-tri(propan-2-yl)silyloxy-2,8,12,18-tetraoxatetracyclo[9.9.0.03,9.013,19]icosa-4,15-dien-6-ol.
| Compound Name | (1R,3R,6S,7R,9S,11R,13S,19S,20R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-20-tri(propan-2-yl)silyloxy-2,8,12,18-tetraoxatetracyclo[9.9.0.03,9.013,19]icosa-4,15-dien-6-ol |
|---|---|
| PubChem CID | 102573214 |
| Molecular Formula | C32H58O7Si2 |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | (1R,3R,6S,7R,9S,11R,13S,19S,20R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-20-tri(propan-2-yl)silyloxy-2,8,12,18-tetraoxatetracyclo[9.9.0.03,9.013,19]icosa-4,15-dien-6-ol |
| SMILES | CC(C)[Si](O[C@@H]1[C@H]2OCC=CC[C@@H]2O[C@@H]2C[C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)C=C[C@H]3O[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H58O7Si2/c1-20(2)41(21(3)4,22(5)6)39-31-29-25(14-12-13-17-34-29)36-27-18-26-24(38-30(27)31)16-15-23(33)28(37-26)19-35-40(10,11)32(7,8)9/h12-13,15-16,20-31,33H,14,17-19H2,1-11H3/t23-,24+,25-,26-,27+,28+,29-,30+,31+/m0/s1 |
| InChIKey | VZDUDXDLQWNRLE-FPNHKJDSSA-N |
| XLogP | 6.52 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|