C28H48OSi — CID 102573368
tert-butyl-[(2E,7E)-4-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane (PubChem CID 102573368) has the molecular formula C28H48OSi and a molecular weight of 428.78 g/mol. Its IUPAC name is tert-butyl-[(2E,7E)-4-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,7E)-4-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102573368 |
| Molecular Formula | C28H48OSi |
| Molecular Weight | 428.78 g/mol |
| Exact Mass | 428.35 |
| IUPAC Name | tert-butyl-[(2E,7E)-4-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane |
| SMILES | CCC(=C=C/C(C)=C/CC1=C(C)CCCC1(C)C)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H48OSi/c1-12-25(23(3)19-21-29-30(10,11)27(5,6)7)17-15-22(2)16-18-26-24(4)14-13-20-28(26,8)9/h15-16,19H,12-14,18,20-21H2,1-11H3/b22-16+,23-19+ |
| InChIKey | JYZFPPGIADIHLU-SZAMPSRSSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.78 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|