C18H30O3S — CID 102573450
(1S,6R,8R,13S)-3,3-dimethyl-13-(2-methylpropylsulfanylmethyl)-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one (PubChem CID 102573450) has the molecular formula C18H30O3S and a molecular weight of 326.50 g/mol. Its IUPAC name is (1S,6R,8R,13S)-3,3-dimethyl-13-(2-methylpropylsulfanylmethyl)-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one.
| Compound Name | (1S,6R,8R,13S)-3,3-dimethyl-13-(2-methylpropylsulfanylmethyl)-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one |
|---|---|
| PubChem CID | 102573450 |
| Molecular Formula | C18H30O3S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (1S,6R,8R,13S)-3,3-dimethyl-13-(2-methylpropylsulfanylmethyl)-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one |
| SMILES | CC(C)CSC[C@H]1CCCC[C@@H]2C[C@H]3C(=O)OC(C)(C)O[C@@]123 |
| InChI | InChI=1S/C18H30O3S/c1-12(2)10-22-11-14-8-6-5-7-13-9-15-16(19)20-17(3,4)21-18(13,14)15/h12-15H,5-11H2,1-4H3/t13-,14-,15+,18-/m1/s1 |
| InChIKey | KINKFACIYYJCGF-ZXFNITATSA-N |
| XLogP | 4.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |