C14H20O3 — CID 102573451
(1S,6R,8R)-3,3-dimethyl-13-methylidene-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one (PubChem CID 102573451) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S,6R,8R)-3,3-dimethyl-13-methylidene-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one.
| Compound Name | (1S,6R,8R)-3,3-dimethyl-13-methylidene-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one |
|---|---|
| PubChem CID | 102573451 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S,6R,8R)-3,3-dimethyl-13-methylidene-2,4-dioxatricyclo[6.5.0.01,6]tridecan-5-one |
| SMILES | C=C1CCCC[C@@H]2C[C@H]3C(=O)OC(C)(C)O[C@@]123 |
| InChI | InChI=1S/C14H20O3/c1-9-6-4-5-7-10-8-11-12(15)16-13(2,3)17-14(9,10)11/h10-11H,1,4-8H2,2-3H3/t10-,11+,14+/m1/s1 |
| InChIKey | VLAFQYIZYCZRFJ-SUNKGSAMSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|