C26H26O6 — CID 102573459
(10R,13R,14S)-13-hydroxy-10,14-diphenyl-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione (PubChem CID 102573459) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is (10R,13R,14S)-13-hydroxy-10,14-diphenyl-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione.
| Compound Name | (10R,13R,14S)-13-hydroxy-10,14-diphenyl-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione |
|---|---|
| PubChem CID | 102573459 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (10R,13R,14S)-13-hydroxy-10,14-diphenyl-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione |
| SMILES | O=C1C[C@H](c2ccccc2)C2(C(=O)OC3(CCCCC3)OC2=O)[C@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C26H26O6/c27-20-16-19(17-10-4-1-5-11-17)26(21(22(20)28)18-12-6-2-7-13-18)23(29)31-25(32-24(26)30)14-8-3-9-15-25/h1-2,4-7,10-13,19,21-22,28H,3,8-9,14-16H2/t19-,21-,22+/m1/s1 |
| InChIKey | OEEWCNFSSKGUEW-FCEUIQTBSA-N |
| XLogP | 3.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|