About 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid
3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid (PubChem CID 102573476) has the molecular formula C14H16F3NO2S2
and a molecular weight of 351.42 g/mol. Its IUPAC name is 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid |
| PubChem CID | 102573476 |
| Molecular Formula | C14H16F3NO2S2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid |
| SMILES | CCSC(SCC)=C(Cc1cccnc1C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2S2/c1-3-21-13(22-4-2)10(14(15,16)17)8-9-6-5-7-18-11(9)12(19)20/h5-7H,3-4,8H2,1-2H3,(H,19,20) |
| InChIKey | LQVZVAMDLIZJBC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid?
The IUPAC name of 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid (CID 102573476) is 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid?
The canonical SMILES for 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid is CCSC(SCC)=C(Cc1cccnc1C(=O)O)C(F)(F)F.
What is the InChIKey of 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid?
The InChIKey is LQVZVAMDLIZJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3NO2S2/c1-3-21-13(22-4-2)10(14(15,16)17)8-9-6-5-7-18-11(9)12(19)20/h5-7H,3-4,8H2,1-2H3,(H,19,20).
What are the key properties of 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid?
3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid has a molecular weight of 351.42 g/mol, XLogP of 4.60, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-bis(ethylsulfanyl)-2-(trifluoromethyl)prop-2-enyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 102573476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).