C32H39NO6S — CID 10257351
3-[[6-(2-carboxyethyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methylsulfanylmethyl]benzoic acid (PubChem CID 10257351) has the molecular formula C32H39NO6S and a molecular weight of 565.73 g/mol. Its IUPAC name is 3-[[6-(2-carboxyethyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methylsulfanylmethyl]benzoic acid.
| Compound Name | 3-[[6-(2-carboxyethyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methylsulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 10257351 |
| Molecular Formula | C32H39NO6S |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 3-[[6-(2-carboxyethyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methylsulfanylmethyl]benzoic acid |
| SMILES | COc1ccc(CCCCCCCCOc2ccc(CSCc3cccc(C(=O)O)c3)nc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C32H39NO6S/c1-38-28-15-12-24(13-16-28)9-6-4-2-3-5-7-20-39-30-18-14-27(33-29(30)17-19-31(34)35)23-40-22-25-10-8-11-26(21-25)32(36)37/h8,10-16,18,21H,2-7,9,17,19-20,22-23H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | VTDWCJMFUAYBML-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|