C21H18F4N2O6S3 — CID 10257361
N-[(1S)-1-[4-[4-amino-2-(2-fluorophenyl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 10257361) has the molecular formula C21H18F4N2O6S3 and a molecular weight of 566.58 g/mol. Its IUPAC name is N-[(1S)-1-[4-[4-amino-2-(2-fluorophenyl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(1S)-1-[4-[4-amino-2-(2-fluorophenyl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 10257361 |
| Molecular Formula | C21H18F4N2O6S3 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | N-[(1S)-1-[4-[4-amino-2-(2-fluorophenyl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)C(F)(F)F)c1ccc(S(=O)(=O)c2ccc(N)cc2S(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H18F4N2O6S3/c1-13(27-36(32,33)21(23,24)25)14-6-9-16(10-7-14)34(28,29)19-11-8-15(26)12-20(19)35(30,31)18-5-3-2-4-17(18)22/h2-13,27H,26H2,1H3/t13-/m0/s1 |
| InChIKey | PMIRIEIFLULQEW-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|