C15H28O4Si — CID 102573699
(3aS,5R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one (PubChem CID 102573699) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (3aS,5R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one.
| Compound Name | (3aS,5R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 102573699 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3aS,5R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one |
| SMILES | CC1(C)O[C@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]2O1 |
| InChI | InChI=1S/C15H28O4Si/c1-14(2,3)20(6,7)19-10-8-9-11-13(12(10)16)18-15(4,5)17-11/h10-11,13H,8-9H2,1-7H3/t10-,11+,13+/m1/s1 |
| InChIKey | BOBMAEKZBGIQGT-MDZLAQPJSA-N |
| XLogP | 3.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|