About 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene
4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene (PubChem CID 102573785) has the molecular formula C12H6S4
and a molecular weight of 278.45 g/mol. Its IUPAC name is 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene.
Molecular Properties
| Compound Name | 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene |
| PubChem CID | 102573785 |
| Molecular Formula | C12H6S4 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene |
| SMILES | c1cc2c(-c3scc4sccc34)scc2s1 |
| InChI | InChI=1S/C12H6S4/c1-3-13-9-5-15-11(7(1)9)12-8-2-4-14-10(8)6-16-12/h1-6H |
| InChIKey | YRLDRLMJIDULFY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene?
The IUPAC name of 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene (CID 102573785) is 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene.
What is the SMILES notation for 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene?
The canonical SMILES for 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene is c1cc2c(-c3scc4sccc34)scc2s1.
What is the InChIKey of 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene?
The InChIKey is YRLDRLMJIDULFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6S4/c1-3-13-9-5-15-11(7(1)9)12-8-2-4-14-10(8)6-16-12/h1-6H.
What are the key properties of 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene?
4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene has a molecular weight of 278.45 g/mol, XLogP of 5.91, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thieno[2,3-c]thiophen-4-ylthieno[2,3-c]thiophene is sourced from PubChem (CID 102573785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).