About CID 102573852
CID 102573852 (PubChem CID 102573852) has the molecular formula C34H52GeSi2
and a molecular weight of 589.57 g/mol.
Molecular Properties
| Compound Name | CID 102573852 |
| PubChem CID | 102573852 |
| Molecular Formula | C34H52GeSi2 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](C1=C(c2ccccc2)C(c2ccccc2)=C([Si](C(C)C)(C(C)C)C(C)C)[Ge]1)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H52GeSi2/c1-23(2)36(24(3)4,25(5)6)33-31(29-19-15-13-16-20-29)32(30-21-17-14-18-22-30)34(35-33)37(26(7)8,27(9)10)28(11)12/h13-28H,1-12H3 |
| InChIKey | JJOBPJJMLADESR-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 102573852 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102573852?
The IUPAC name of CID 102573852 (CID 102573852) is not available.
What is the SMILES notation for CID 102573852?
The canonical SMILES for CID 102573852 is CC(C)[Si](C1=C(c2ccccc2)C(c2ccccc2)=C([Si](C(C)C)(C(C)C)C(C)C)[Ge]1)(C(C)C)C(C)C.
What is the InChIKey of CID 102573852?
The InChIKey is JJOBPJJMLADESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H52GeSi2/c1-23(2)36(24(3)4,25(5)6)33-31(29-19-15-13-16-20-29)32(30-21-17-14-18-22-30)34(35-33)37(26(7)8,27(9)10)28(11)12/h13-28H,1-12H3.
What are the key properties of CID 102573852?
CID 102573852 has a molecular weight of 589.57 g/mol, XLogP of 10.96, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102573852 is sourced from PubChem (CID 102573852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).