C17H10Cl4O2S — CID 102573926
(Z)-1,4-bis(3,4-dichlorophenyl)-2-methylsulfanylbut-2-ene-1,4-dione (PubChem CID 102573926) has the molecular formula C17H10Cl4O2S and a molecular weight of 420.14 g/mol. Its IUPAC name is (Z)-1,4-bis(3,4-dichlorophenyl)-2-methylsulfanylbut-2-ene-1,4-dione.
| Compound Name | (Z)-1,4-bis(3,4-dichlorophenyl)-2-methylsulfanylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 102573926 |
| Molecular Formula | C17H10Cl4O2S |
| Molecular Weight | 420.14 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | (Z)-1,4-bis(3,4-dichlorophenyl)-2-methylsulfanylbut-2-ene-1,4-dione |
| SMILES | CS/C(=C\C(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl4O2S/c1-24-16(17(23)10-3-5-12(19)14(21)7-10)8-15(22)9-2-4-11(18)13(20)6-9/h2-8H,1H3/b16-8- |
| InChIKey | PRMOXJQHICWDRI-PXNMLYILSA-N |
| XLogP | 6.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.14 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|