C26H52OSi4 — CID 102574004
[(1S,2S)-4-(1-adamantyl)-2-tert-butyl-1,2-bis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane (PubChem CID 102574004) has the molecular formula C26H52OSi4 and a molecular weight of 493.05 g/mol. Its IUPAC name is [(1S,2S)-4-(1-adamantyl)-2-tert-butyl-1,2-bis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane.
| Compound Name | [(1S,2S)-4-(1-adamantyl)-2-tert-butyl-1,2-bis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 102574004 |
| Molecular Formula | C26H52OSi4 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(1S,2S)-4-(1-adamantyl)-2-tert-butyl-1,2-bis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)[C@]1([Si](C)(C)C)C=C(C23CC4CC(CC(C4)C2)C3)[Si@]1(O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C26H52OSi4/c1-24(2,3)26(28(4,5)6)19-23(31(26,30(10,11)12)27-29(7,8)9)25-16-20-13-21(17-25)15-22(14-20)18-25/h19-22H,13-18H2,1-12H3/t20?,21?,22?,25?,26-,31-/m0/s1 |
| InChIKey | HEVIJGQVGRBRSB-JUBFISNXSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|